C9H16O6S — CID 154516629
3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpropanal (PubChem CID 154516629) has the molecular formula C9H16O6S and a molecular weight of 252.29 g/mol. Its IUPAC name is 3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpropanal.
| Compound Name | 3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpropanal |
|---|---|
| PubChem CID | 154516629 |
| Molecular Formula | C9H16O6S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpropanal |
| SMILES | O=CCCSC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C9H16O6S/c10-2-1-3-16-9-8(14)7(13)6(12)5(4-11)15-9/h2,5-9,11-14H,1,3-4H2 |
| InChIKey | HYANGHUCVMHWOJ-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|