About (propan-2-ylideneamino) ethanimidothioate
(propan-2-ylideneamino) ethanimidothioate (PubChem CID 154517434) has the molecular formula C5H10N2S
and a molecular weight of 130.22 g/mol. Its IUPAC name is (propan-2-ylideneamino) ethanimidothioate.
Molecular Properties
| Compound Name | (propan-2-ylideneamino) ethanimidothioate |
| PubChem CID | 154517434 |
| Molecular Formula | C5H10N2S |
| Molecular Weight | 130.22 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | (propan-2-ylideneamino) ethanimidothioate |
| SMILES | [H]/N=C(\C)SN=C(C)C |
| InChI | InChI=1S/C5H10N2S/c1-4(2)7-8-5(3)6/h6H,1-3H3/b6-5+ |
| InChIKey | HXTWIUGSLLTRKV-AATRIKPKSA-N |
| XLogP | 2.11 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.22 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (propan-2-ylideneamino) ethanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (propan-2-ylideneamino) ethanimidothioate?
The IUPAC name of (propan-2-ylideneamino) ethanimidothioate (CID 154517434) is (propan-2-ylideneamino) ethanimidothioate.
What is the SMILES notation for (propan-2-ylideneamino) ethanimidothioate?
The canonical SMILES for (propan-2-ylideneamino) ethanimidothioate is [H]/N=C(\C)SN=C(C)C.
What is the InChIKey of (propan-2-ylideneamino) ethanimidothioate?
The InChIKey is HXTWIUGSLLTRKV-AATRIKPKSA-N. The full InChI is InChI=1S/C5H10N2S/c1-4(2)7-8-5(3)6/h6H,1-3H3/b6-5+.
What are the key properties of (propan-2-ylideneamino) ethanimidothioate?
(propan-2-ylideneamino) ethanimidothioate has a molecular weight of 130.22 g/mol, XLogP of 2.11, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (propan-2-ylideneamino) ethanimidothioate is sourced from PubChem (CID 154517434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).