C5H10N2S — CID 154517436
3,4,5-trimethyl-5H-1,2,4-thiadiazole (PubChem CID 154517436) has the molecular formula C5H10N2S and a molecular weight of 130.22 g/mol. Its IUPAC name is 3,4,5-trimethyl-5H-1,2,4-thiadiazole.
| Compound Name | 3,4,5-trimethyl-5H-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 154517436 |
| Molecular Formula | C5H10N2S |
| Molecular Weight | 130.22 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | 3,4,5-trimethyl-5H-1,2,4-thiadiazole |
| SMILES | CC1=NSC(C)N1C |
| InChI | InChI=1S/C5H10N2S/c1-4-6-8-5(2)7(4)3/h5H,1-3H3 |
| InChIKey | MZWBEQWPEPDIDS-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.22 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|