About 4-[3,3-bis(3-fluoro-4-methoxyphenyl)benzo[f]chromen-6-yl]morpholine
4-[3,3-bis(3-fluoro-4-methoxyphenyl)benzo[f]chromen-6-yl]morpholine (PubChem CID 15451746) has the molecular formula C31H27F2NO4
and a molecular weight of 515.56 g/mol. Its IUPAC name is 4-[3,3-bis(3-fluoro-4-methoxyphenyl)benzo[f]chromen-6-yl]morpholine.
Molecular Properties
| Compound Name | 4-[3,3-bis(3-fluoro-4-methoxyphenyl)benzo[f]chromen-6-yl]morpholine |
| PubChem CID | 15451746 |
| Molecular Formula | C31H27F2NO4 |
| Molecular Weight | 515.56 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | 4-[3,3-bis(3-fluoro-4-methoxyphenyl)benzo[f]chromen-6-yl]morpholine |
| SMILES | COc1ccc(C2(c3ccc(OC)c(F)c3)C=Cc3c(cc(N4CCOCC4)c4ccccc34)O2)cc1F |
| InChI | InChI=1S/C31H27F2NO4/c1-35-28-9-7-20(17-25(28)32)31(21-8-10-29(36-2)26(33)18-21)12-11-24-22-5-3-4-6-23(22)27(19-30(24)38-31)34-13-15-37-16-14-34/h3-12,17-19H,13-16H2,1-2H3 |
| InChIKey | JPASYLQREITSEV-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 515.56 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|
Analyze 4-[3,3-bis(3-fluoro-4-methoxyphenyl)benzo[f]chromen-6-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3,3-bis(3-fluoro-4-methoxyphenyl)benzo[f]chromen-6-yl]morpholine?
The IUPAC name of 4-[3,3-bis(3-fluoro-4-methoxyphenyl)benzo[f]chromen-6-yl]morpholine (CID 15451746) is 4-[3,3-bis(3-fluoro-4-methoxyphenyl)benzo[f]chromen-6-yl]morpholine.
What is the SMILES notation for 4-[3,3-bis(3-fluoro-4-methoxyphenyl)benzo[f]chromen-6-yl]morpholine?
The canonical SMILES for 4-[3,3-bis(3-fluoro-4-methoxyphenyl)benzo[f]chromen-6-yl]morpholine is COc1ccc(C2(c3ccc(OC)c(F)c3)C=Cc3c(cc(N4CCOCC4)c4ccccc34)O2)cc1F.
What is the InChIKey of 4-[3,3-bis(3-fluoro-4-methoxyphenyl)benzo[f]chromen-6-yl]morpholine?
The InChIKey is JPASYLQREITSEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H27F2NO4/c1-35-28-9-7-20(17-25(28)32)31(21-8-10-29(36-2)26(33)18-21)12-11-24-22-5-3-4-6-23(22)27(19-30(24)38-31)34-13-15-37-16-14-34/h3-12,17-19H,13-16H2,1-2H3.
What are the key properties of 4-[3,3-bis(3-fluoro-4-methoxyphenyl)benzo[f]chromen-6-yl]morpholine?
4-[3,3-bis(3-fluoro-4-methoxyphenyl)benzo[f]chromen-6-yl]morpholine has a molecular weight of 515.56 g/mol, XLogP of 6.32, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3,3-bis(3-fluoro-4-methoxyphenyl)benzo[f]chromen-6-yl]morpholine is sourced from PubChem (CID 15451746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).