C12H8F4N2O2S — CID 15451838
5-methyl-3-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-imine (PubChem CID 15451838) has the molecular formula C12H8F4N2O2S and a molecular weight of 320.27 g/mol. Its IUPAC name is 5-methyl-3-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-imine.
| Compound Name | 5-methyl-3-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 15451838 |
| Molecular Formula | C12H8F4N2O2S |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 5-methyl-3-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-imine |
| SMILES | [H]/N=c1\sc(C)cn1-c1ccc2c(c1)OC(F)(F)C(F)(F)O2 |
| InChI | InChI=1S/C12H8F4N2O2S/c1-6-5-18(10(17)21-6)7-2-3-8-9(4-7)20-12(15,16)11(13,14)19-8/h2-5,17H,1H3/b17-10- |
| InChIKey | AKPZUSFJYZZUAN-YVLHZVERSA-N |
| XLogP | 3.28 |
| TPSA | 47.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|