C6H4F7N — CID 154520155
4,4,5,5,6,6,6-heptafluorohex-1-en-3-imine (PubChem CID 154520155) has the molecular formula C6H4F7N and a molecular weight of 223.09 g/mol. Its IUPAC name is 4,4,5,5,6,6,6-heptafluorohex-1-en-3-imine.
| Compound Name | 4,4,5,5,6,6,6-heptafluorohex-1-en-3-imine |
|---|---|
| PubChem CID | 154520155 |
| Molecular Formula | C6H4F7N |
| Molecular Weight | 223.09 g/mol |
| Exact Mass | 223.02 |
| IUPAC Name | 4,4,5,5,6,6,6-heptafluorohex-1-en-3-imine |
| SMILES | [H]/N=C(\C=C)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H4F7N/c1-2-3(14)4(7,8)5(9,10)6(11,12)13/h2,14H,1H2/b14-3+ |
| InChIKey | FHBNDLUTHVHTID-LZWSPWQCSA-N |
| XLogP | 3.03 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.09 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|