C19H23BrN4O — CID 154521131
3-[(6aR,9S)-5-bromo-4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea (PubChem CID 154521131) has the molecular formula C19H23BrN4O and a molecular weight of 403.32 g/mol. Its IUPAC name is 3-[(6aR,9S)-5-bromo-4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea.
| Compound Name | 3-[(6aR,9S)-5-bromo-4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea |
|---|---|
| PubChem CID | 154521131 |
| Molecular Formula | C19H23BrN4O |
| Molecular Weight | 403.32 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 3-[(6aR,9S)-5-bromo-4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)N[C@H]1C=C2c3cccc4[nH]c(Br)c(c34)C[C@H]2NC1 |
| InChI | InChI=1S/C19H23BrN4O/c1-3-24(4-2)19(25)22-11-8-13-12-6-5-7-15-17(12)14(18(20)23-15)9-16(13)21-10-11/h5-8,11,16,21,23H,3-4,9-10H2,1-2H3,(H,22,25)/t11-,16+/m0/s1 |
| InChIKey | SSVMJGRIHRCOIX-MEDUHNTESA-N |
| XLogP | 3.26 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |