About 2-nitro-4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine
2-nitro-4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine (PubChem CID 154521618) has the molecular formula C7H8F3N3O2
and a molecular weight of 223.15 g/mol. Its IUPAC name is 2-nitro-4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine.
Molecular Properties
| Compound Name | 2-nitro-4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine |
| PubChem CID | 154521618 |
| Molecular Formula | C7H8F3N3O2 |
| Molecular Weight | 223.15 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 2-nitro-4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine |
| SMILES | NC1=C([N+](=O)[O-])CC(N)(C(F)(F)F)C=C1 |
| InChI | InChI=1S/C7H8F3N3O2/c8-7(9,10)6(12)2-1-4(11)5(3-6)13(14)15/h1-2H,3,11-12H2 |
| InChIKey | JEXBGCMVPHCIKM-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.15 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitro-4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitro-4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine?
The IUPAC name of 2-nitro-4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine (CID 154521618) is 2-nitro-4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine.
What is the SMILES notation for 2-nitro-4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine?
The canonical SMILES for 2-nitro-4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine is NC1=C([N+](=O)[O-])CC(N)(C(F)(F)F)C=C1.
What is the InChIKey of 2-nitro-4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine?
The InChIKey is JEXBGCMVPHCIKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F3N3O2/c8-7(9,10)6(12)2-1-4(11)5(3-6)13(14)15/h1-2H,3,11-12H2.
What are the key properties of 2-nitro-4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine?
2-nitro-4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine has a molecular weight of 223.15 g/mol, XLogP of 0.65, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitro-4-(trifluoromethyl)cyclohexa-1,5-diene-1,4-diamine is sourced from PubChem (CID 154521618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).