About (2Z,6Z)-2,6-di(ethylidene)cyclohexan-1-ol
(2Z,6Z)-2,6-di(ethylidene)cyclohexan-1-ol (PubChem CID 154521747) has the molecular formula C10H16O
and a molecular weight of 152.24 g/mol. Its IUPAC name is (2Z,6Z)-2,6-di(ethylidene)cyclohexan-1-ol.
Molecular Properties
| Compound Name | (2Z,6Z)-2,6-di(ethylidene)cyclohexan-1-ol |
| PubChem CID | 154521747 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | (2Z,6Z)-2,6-di(ethylidene)cyclohexan-1-ol |
| SMILES | C/C=C1/CCC/C(=C/C)C1O |
| InChI | InChI=1S/C10H16O/c1-3-8-6-5-7-9(4-2)10(8)11/h3-4,10-11H,5-7H2,1-2H3/b8-3-,9-4- |
| InChIKey | ANQQMUNEMOAPJR-ZATFKQDHSA-N |
| XLogP | 2.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,6Z)-2,6-di(ethylidene)cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,6Z)-2,6-di(ethylidene)cyclohexan-1-ol?
The IUPAC name of (2Z,6Z)-2,6-di(ethylidene)cyclohexan-1-ol (CID 154521747) is (2Z,6Z)-2,6-di(ethylidene)cyclohexan-1-ol.
What is the SMILES notation for (2Z,6Z)-2,6-di(ethylidene)cyclohexan-1-ol?
The canonical SMILES for (2Z,6Z)-2,6-di(ethylidene)cyclohexan-1-ol is C/C=C1/CCC/C(=C/C)C1O.
What is the InChIKey of (2Z,6Z)-2,6-di(ethylidene)cyclohexan-1-ol?
The InChIKey is ANQQMUNEMOAPJR-ZATFKQDHSA-N. The full InChI is InChI=1S/C10H16O/c1-3-8-6-5-7-9(4-2)10(8)11/h3-4,10-11H,5-7H2,1-2H3/b8-3-,9-4-.
What are the key properties of (2Z,6Z)-2,6-di(ethylidene)cyclohexan-1-ol?
(2Z,6Z)-2,6-di(ethylidene)cyclohexan-1-ol has a molecular weight of 152.24 g/mol, XLogP of 2.42, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,6Z)-2,6-di(ethylidene)cyclohexan-1-ol is sourced from PubChem (CID 154521747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).