C16H12F4N4O — CID 15452276
2-(4-fluorophenyl)-5-methyl-4-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxypyrimidine (PubChem CID 15452276) has the molecular formula C16H12F4N4O and a molecular weight of 352.29 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5-methyl-4-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxypyrimidine.
| Compound Name | 2-(4-fluorophenyl)-5-methyl-4-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxypyrimidine |
|---|---|
| PubChem CID | 15452276 |
| Molecular Formula | C16H12F4N4O |
| Molecular Weight | 352.29 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 2-(4-fluorophenyl)-5-methyl-4-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxypyrimidine |
| SMILES | Cc1cnc(-c2ccc(F)cc2)nc1Oc1cc(C(F)(F)F)nn1C |
| InChI | InChI=1S/C16H12F4N4O/c1-9-8-21-14(10-3-5-11(17)6-4-10)22-15(9)25-13-7-12(16(18,19)20)23-24(13)2/h3-8H,1-2H3 |
| InChIKey | AJQYZGDTKOPYLE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.29 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |