C21H15F2NOS — CID 15452320
4-[4-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenyl]benzenethiol (PubChem CID 15452320) has the molecular formula C21H15F2NOS and a molecular weight of 367.42 g/mol. Its IUPAC name is 4-[4-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenyl]benzenethiol.
| Compound Name | 4-[4-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenyl]benzenethiol |
|---|---|
| PubChem CID | 15452320 |
| Molecular Formula | C21H15F2NOS |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 4-[4-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenyl]benzenethiol |
| SMILES | Fc1cccc(F)c1C1=NC(c2ccc(-c3ccc(S)cc3)cc2)CO1 |
| InChI | InChI=1S/C21H15F2NOS/c22-17-2-1-3-18(23)20(17)21-24-19(12-25-21)15-6-4-13(5-7-15)14-8-10-16(26)11-9-14/h1-11,19,26H,12H2 |
| InChIKey | DYLKIDTVWHOURU-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 21.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|