About 5-[4-(4-ethylcyclohexyl)cyclohexyl]-2,2-difluoro-1,3-dioxane
5-[4-(4-ethylcyclohexyl)cyclohexyl]-2,2-difluoro-1,3-dioxane (PubChem CID 154524113) has the molecular formula C18H30F2O2
and a molecular weight of 316.43 g/mol. Its IUPAC name is 5-[4-(4-ethylcyclohexyl)cyclohexyl]-2,2-difluoro-1,3-dioxane.
Molecular Properties
| Compound Name | 5-[4-(4-ethylcyclohexyl)cyclohexyl]-2,2-difluoro-1,3-dioxane |
| PubChem CID | 154524113 |
| Molecular Formula | C18H30F2O2 |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 5-[4-(4-ethylcyclohexyl)cyclohexyl]-2,2-difluoro-1,3-dioxane |
| SMILES | CCC1CCC(C2CCC(C3COC(F)(F)OC3)CC2)CC1 |
| InChI | InChI=1S/C18H30F2O2/c1-2-13-3-5-14(6-4-13)15-7-9-16(10-8-15)17-11-21-18(19,20)22-12-17/h13-17H,2-12H2,1H3 |
| InChIKey | SRNIQRYKVOWWIJ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[4-(4-ethylcyclohexyl)cyclohexyl]-2,2-difluoro-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(4-ethylcyclohexyl)cyclohexyl]-2,2-difluoro-1,3-dioxane?
The IUPAC name of 5-[4-(4-ethylcyclohexyl)cyclohexyl]-2,2-difluoro-1,3-dioxane (CID 154524113) is 5-[4-(4-ethylcyclohexyl)cyclohexyl]-2,2-difluoro-1,3-dioxane.
What is the SMILES notation for 5-[4-(4-ethylcyclohexyl)cyclohexyl]-2,2-difluoro-1,3-dioxane?
The canonical SMILES for 5-[4-(4-ethylcyclohexyl)cyclohexyl]-2,2-difluoro-1,3-dioxane is CCC1CCC(C2CCC(C3COC(F)(F)OC3)CC2)CC1.
What is the InChIKey of 5-[4-(4-ethylcyclohexyl)cyclohexyl]-2,2-difluoro-1,3-dioxane?
The InChIKey is SRNIQRYKVOWWIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30F2O2/c1-2-13-3-5-14(6-4-13)15-7-9-16(10-8-15)17-11-21-18(19,20)22-12-17/h13-17H,2-12H2,1H3.
What are the key properties of 5-[4-(4-ethylcyclohexyl)cyclohexyl]-2,2-difluoro-1,3-dioxane?
5-[4-(4-ethylcyclohexyl)cyclohexyl]-2,2-difluoro-1,3-dioxane has a molecular weight of 316.43 g/mol, XLogP of 5.22, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(4-ethylcyclohexyl)cyclohexyl]-2,2-difluoro-1,3-dioxane is sourced from PubChem (CID 154524113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).