C14H22F2O2 — CID 154524154
2,2-difluoro-4-[(E)-2-(4-propylcyclohexyl)ethenyl]-1,3-dioxolane (PubChem CID 154524154) has the molecular formula C14H22F2O2 and a molecular weight of 260.32 g/mol. Its IUPAC name is 2,2-difluoro-4-[(E)-2-(4-propylcyclohexyl)ethenyl]-1,3-dioxolane.
| Compound Name | 2,2-difluoro-4-[(E)-2-(4-propylcyclohexyl)ethenyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 154524154 |
| Molecular Formula | C14H22F2O2 |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 2,2-difluoro-4-[(E)-2-(4-propylcyclohexyl)ethenyl]-1,3-dioxolane |
| SMILES | CCCC1CCC(/C=C/C2COC(F)(F)O2)CC1 |
| InChI | InChI=1S/C14H22F2O2/c1-2-3-11-4-6-12(7-5-11)8-9-13-10-17-14(15,16)18-13/h8-9,11-13H,2-7,10H2,1H3/b9-8+ |
| InChIKey | DHGOERFUNAAYKU-CMDGGOBGSA-N |
| XLogP | 4.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|