About 2,2-difluoro-5-(4-propylcyclohexyl)-3,4-dihydropyran
2,2-difluoro-5-(4-propylcyclohexyl)-3,4-dihydropyran (PubChem CID 154524202) has the molecular formula C14H22F2O
and a molecular weight of 244.32 g/mol. Its IUPAC name is 2,2-difluoro-5-(4-propylcyclohexyl)-3,4-dihydropyran.
Molecular Properties
| Compound Name | 2,2-difluoro-5-(4-propylcyclohexyl)-3,4-dihydropyran |
| PubChem CID | 154524202 |
| Molecular Formula | C14H22F2O |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 2,2-difluoro-5-(4-propylcyclohexyl)-3,4-dihydropyran |
| SMILES | CCCC1CCC(C2=COC(F)(F)CC2)CC1 |
| InChI | InChI=1S/C14H22F2O/c1-2-3-11-4-6-12(7-5-11)13-8-9-14(15,16)17-10-13/h10-12H,2-9H2,1H3 |
| InChIKey | ZBDMEJMYKNUFND-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,2-difluoro-5-(4-propylcyclohexyl)-3,4-dihydropyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-5-(4-propylcyclohexyl)-3,4-dihydropyran?
The IUPAC name of 2,2-difluoro-5-(4-propylcyclohexyl)-3,4-dihydropyran (CID 154524202) is 2,2-difluoro-5-(4-propylcyclohexyl)-3,4-dihydropyran.
What is the SMILES notation for 2,2-difluoro-5-(4-propylcyclohexyl)-3,4-dihydropyran?
The canonical SMILES for 2,2-difluoro-5-(4-propylcyclohexyl)-3,4-dihydropyran is CCCC1CCC(C2=COC(F)(F)CC2)CC1.
What is the InChIKey of 2,2-difluoro-5-(4-propylcyclohexyl)-3,4-dihydropyran?
The InChIKey is ZBDMEJMYKNUFND-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22F2O/c1-2-3-11-4-6-12(7-5-11)13-8-9-14(15,16)17-10-13/h10-12H,2-9H2,1H3.
What are the key properties of 2,2-difluoro-5-(4-propylcyclohexyl)-3,4-dihydropyran?
2,2-difluoro-5-(4-propylcyclohexyl)-3,4-dihydropyran has a molecular weight of 244.32 g/mol, XLogP of 4.88, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-5-(4-propylcyclohexyl)-3,4-dihydropyran is sourced from PubChem (CID 154524202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).