C28H32N2O10 — CID 15452498
[(3S,6S,7R,8R)-3-[(3-acetyloxy-4-methoxypyridine-2-carbonyl)amino]-8-benzyl-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate (PubChem CID 15452498) has the molecular formula C28H32N2O10 and a molecular weight of 556.57 g/mol. Its IUPAC name is [(3S,6S,7R,8R)-3-[(3-acetyloxy-4-methoxypyridine-2-carbonyl)amino]-8-benzyl-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate.
| Compound Name | [(3S,6S,7R,8R)-3-[(3-acetyloxy-4-methoxypyridine-2-carbonyl)amino]-8-benzyl-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 15452498 |
| Molecular Formula | C28H32N2O10 |
| Molecular Weight | 556.57 g/mol |
| Exact Mass | 556.21 |
| IUPAC Name | [(3S,6S,7R,8R)-3-[(3-acetyloxy-4-methoxypyridine-2-carbonyl)amino]-8-benzyl-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate |
| SMILES | COc1ccnc(C(=O)N[C@H]2COC(=O)[C@H](Cc3ccccc3)[C@@H](OC(=O)C(C)C)[C@H](C)OC2=O)c1OC(C)=O |
| InChI | InChI=1S/C28H32N2O10/c1-15(2)26(33)40-23-16(3)38-28(35)20(14-37-27(34)19(23)13-18-9-7-6-8-10-18)30-25(32)22-24(39-17(4)31)21(36-5)11-12-29-22/h6-12,15-16,19-20,23H,13-14H2,1-5H3,(H,30,32)/t16-,19+,20-,23-/m0/s1 |
| InChIKey | TTZOASGYLRKMAN-BOWONNERSA-N |
| XLogP | 2.03 |
| TPSA | 156.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.57 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|