About 2,3-difluoro-5,6-dimethylcyclohexa-1,3-diene
2,3-difluoro-5,6-dimethylcyclohexa-1,3-diene (PubChem CID 154525018) has the molecular formula C8H10F2
and a molecular weight of 144.16 g/mol. Its IUPAC name is 2,3-difluoro-5,6-dimethylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 2,3-difluoro-5,6-dimethylcyclohexa-1,3-diene |
| PubChem CID | 154525018 |
| Molecular Formula | C8H10F2 |
| Molecular Weight | 144.16 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | 2,3-difluoro-5,6-dimethylcyclohexa-1,3-diene |
| SMILES | CC1C=C(F)C(F)=CC1C |
| InChI | InChI=1S/C8H10F2/c1-5-3-7(9)8(10)4-6(5)2/h3-6H,1-2H3 |
| InChIKey | GDZANGWMPOXHQI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.16 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,3-difluoro-5,6-dimethylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-difluoro-5,6-dimethylcyclohexa-1,3-diene?
The IUPAC name of 2,3-difluoro-5,6-dimethylcyclohexa-1,3-diene (CID 154525018) is 2,3-difluoro-5,6-dimethylcyclohexa-1,3-diene.
What is the SMILES notation for 2,3-difluoro-5,6-dimethylcyclohexa-1,3-diene?
The canonical SMILES for 2,3-difluoro-5,6-dimethylcyclohexa-1,3-diene is CC1C=C(F)C(F)=CC1C.
What is the InChIKey of 2,3-difluoro-5,6-dimethylcyclohexa-1,3-diene?
The InChIKey is GDZANGWMPOXHQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F2/c1-5-3-7(9)8(10)4-6(5)2/h3-6H,1-2H3.
What are the key properties of 2,3-difluoro-5,6-dimethylcyclohexa-1,3-diene?
2,3-difluoro-5,6-dimethylcyclohexa-1,3-diene has a molecular weight of 144.16 g/mol, XLogP of 2.98, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-difluoro-5,6-dimethylcyclohexa-1,3-diene is sourced from PubChem (CID 154525018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).