C33H40N2O12 — CID 15452503
7-[[2-[[(3S,7R,8R,9S)-7-benzyl-9-methyl-8-(2-methylpropanoyloxy)-2,6-dioxo-1,5-dioxonan-3-yl]carbamoyl]-4-methoxy-3-pyridinyl]oxy]-7-oxoheptanoic acid (PubChem CID 15452503) has the molecular formula C33H40N2O12 and a molecular weight of 656.68 g/mol. Its IUPAC name is 7-[[2-[[(3S,7R,8R,9S)-7-benzyl-9-methyl-8-(2-methylpropanoyloxy)-2,6-dioxo-1,5-dioxonan-3-yl]carbamoyl]-4-methoxy-3-pyridinyl]oxy]-7-oxoheptanoic acid.
| Compound Name | 7-[[2-[[(3S,7R,8R,9S)-7-benzyl-9-methyl-8-(2-methylpropanoyloxy)-2,6-dioxo-1,5-dioxonan-3-yl]carbamoyl]-4-methoxy-3-pyridinyl]oxy]-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 15452503 |
| Molecular Formula | C33H40N2O12 |
| Molecular Weight | 656.68 g/mol |
| Exact Mass | 656.26 |
| IUPAC Name | 7-[[2-[[(3S,7R,8R,9S)-7-benzyl-9-methyl-8-(2-methylpropanoyloxy)-2,6-dioxo-1,5-dioxonan-3-yl]carbamoyl]-4-methoxy-3-pyridinyl]oxy]-7-oxoheptanoic acid |
| SMILES | COc1ccnc(C(=O)N[C@H]2COC(=O)[C@H](Cc3ccccc3)[C@@H](OC(=O)C(C)C)[C@H](C)OC2=O)c1OC(=O)CCCCCC(=O)O |
| InChI | InChI=1S/C33H40N2O12/c1-19(2)31(40)47-28-20(3)45-33(42)23(18-44-32(41)22(28)17-21-11-7-5-8-12-21)35-30(39)27-29(24(43-4)15-16-34-27)46-26(38)14-10-6-9-13-25(36)37/h5,7-8,11-12,15-16,19-20,22-23,28H,6,9-10,13-14,17-18H2,1-4H3,(H,35,39)(H,36,37)/t20-,22+,23-,28-/m0/s1 |
| InChIKey | YHLAHGPVOLXUFD-HQGMYGGFSA-N |
| XLogP | 3.04 |
| TPSA | 193.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.68 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|