About 3-ethenyltricyclo[6.2.1.02,7]undec-9-ene
3-ethenyltricyclo[6.2.1.02,7]undec-9-ene (PubChem CID 154525054) has the molecular formula C13H18
and a molecular weight of 174.29 g/mol. Its IUPAC name is 3-ethenyltricyclo[6.2.1.02,7]undec-9-ene.
Molecular Properties
| Compound Name | 3-ethenyltricyclo[6.2.1.02,7]undec-9-ene |
| PubChem CID | 154525054 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 3-ethenyltricyclo[6.2.1.02,7]undec-9-ene |
| SMILES | C=CC1CCCC2C3C=CC(C3)C12 |
| InChI | InChI=1S/C13H18/c1-2-9-4-3-5-12-10-6-7-11(8-10)13(9)12/h2,6-7,9-13H,1,3-5,8H2 |
| InChIKey | JZSQRLQCLVGOBC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-ethenyltricyclo[6.2.1.02,7]undec-9-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenyltricyclo[6.2.1.02,7]undec-9-ene?
The IUPAC name of 3-ethenyltricyclo[6.2.1.02,7]undec-9-ene (CID 154525054) is 3-ethenyltricyclo[6.2.1.02,7]undec-9-ene.
What is the SMILES notation for 3-ethenyltricyclo[6.2.1.02,7]undec-9-ene?
The canonical SMILES for 3-ethenyltricyclo[6.2.1.02,7]undec-9-ene is C=CC1CCCC2C3C=CC(C3)C12.
What is the InChIKey of 3-ethenyltricyclo[6.2.1.02,7]undec-9-ene?
The InChIKey is JZSQRLQCLVGOBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18/c1-2-9-4-3-5-12-10-6-7-11(8-10)13(9)12/h2,6-7,9-13H,1,3-5,8H2.
What are the key properties of 3-ethenyltricyclo[6.2.1.02,7]undec-9-ene?
3-ethenyltricyclo[6.2.1.02,7]undec-9-ene has a molecular weight of 174.29 g/mol, XLogP of 3.41, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenyltricyclo[6.2.1.02,7]undec-9-ene is sourced from PubChem (CID 154525054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).