C27H31N3O10 — CID 15452511
[(3S,6S,7R,8R)-8-[(4-formamidophenyl)methyl]-3-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate (PubChem CID 15452511) has the molecular formula C27H31N3O10 and a molecular weight of 557.56 g/mol. Its IUPAC name is [(3S,6S,7R,8R)-8-[(4-formamidophenyl)methyl]-3-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate.
| Compound Name | [(3S,6S,7R,8R)-8-[(4-formamidophenyl)methyl]-3-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 15452511 |
| Molecular Formula | C27H31N3O10 |
| Molecular Weight | 557.56 g/mol |
| Exact Mass | 557.20 |
| IUPAC Name | [(3S,6S,7R,8R)-8-[(4-formamidophenyl)methyl]-3-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate |
| SMILES | COc1ccnc(C(=O)N[C@H]2COC(=O)[C@H](Cc3ccc(NC=O)cc3)[C@@H](OC(=O)C(C)C)[C@H](C)OC2=O)c1O |
| InChI | InChI=1S/C27H31N3O10/c1-14(2)25(34)40-23-15(3)39-27(36)19(30-24(33)21-22(32)20(37-4)9-10-28-21)12-38-26(35)18(23)11-16-5-7-17(8-6-16)29-13-31/h5-10,13-15,18-19,23,32H,11-12H2,1-4H3,(H,29,31)(H,30,33)/t15-,18+,19-,23-/m0/s1 |
| InChIKey | VWWKUIWEUYKWMW-HZNUMKHLSA-N |
| XLogP | 1.38 |
| TPSA | 179.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.56 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|