About 1-cyclopropylazirine
1-cyclopropylazirine (PubChem CID 154525274) has the molecular formula C5H7N
and a molecular weight of 81.12 g/mol. Its IUPAC name is 1-cyclopropylazirine.
Molecular Properties
| Compound Name | 1-cyclopropylazirine |
| PubChem CID | 154525274 |
| Molecular Formula | C5H7N |
| Molecular Weight | 81.12 g/mol |
| Exact Mass | 81.06 |
| IUPAC Name | 1-cyclopropylazirine |
| SMILES | C1=CN1C1CC1 |
| InChI | InChI=1S/C5H7N/c1-2-5(1)6-3-4-6/h3-5H,1-2H2 |
| InChIKey | QOLNGBJWHBRBLE-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 81.12 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclopropylazirine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropylazirine?
The IUPAC name of 1-cyclopropylazirine (CID 154525274) is 1-cyclopropylazirine.
What is the SMILES notation for 1-cyclopropylazirine?
The canonical SMILES for 1-cyclopropylazirine is C1=CN1C1CC1.
What is the InChIKey of 1-cyclopropylazirine?
The InChIKey is QOLNGBJWHBRBLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N/c1-2-5(1)6-3-4-6/h3-5H,1-2H2.
What are the key properties of 1-cyclopropylazirine?
1-cyclopropylazirine has a molecular weight of 81.12 g/mol, XLogP of 0.94, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropylazirine is sourced from PubChem (CID 154525274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).