About (1R)-1-[4-[tert-butyl(dimethyl)silyl]phenyl]-2-phenyl-2-azaspiro[3.5]nonane-3,7-dione
(1R)-1-[4-[tert-butyl(dimethyl)silyl]phenyl]-2-phenyl-2-azaspiro[3.5]nonane-3,7-dione (PubChem CID 154525397) has the molecular formula C26H33NO2Si
and a molecular weight of 419.64 g/mol. Its IUPAC name is (1R)-1-[4-[tert-butyl(dimethyl)silyl]phenyl]-2-phenyl-2-azaspiro[3.5]nonane-3,7-dione.
Molecular Properties
| Compound Name | (1R)-1-[4-[tert-butyl(dimethyl)silyl]phenyl]-2-phenyl-2-azaspiro[3.5]nonane-3,7-dione |
| PubChem CID | 154525397 |
| Molecular Formula | C26H33NO2Si |
| Molecular Weight | 419.64 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | (1R)-1-[4-[tert-butyl(dimethyl)silyl]phenyl]-2-phenyl-2-azaspiro[3.5]nonane-3,7-dione |
| SMILES | CC(C)(C)[Si](C)(C)c1ccc([C@H]2N(c3ccccc3)C(=O)C23CCC(=O)CC3)cc1 |
| InChI | InChI=1S/C26H33NO2Si/c1-25(2,3)30(4,5)22-13-11-19(12-14-22)23-26(17-15-21(28)16-18-26)24(29)27(23)20-9-7-6-8-10-20/h6-14,23H,15-18H2,1-5H3/t23-/m1/s1 |
| InChIKey | XWVDVVWDRZSKPE-HSZRJFAPSA-N |
| XLogP | 5.62 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.64 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (1R)-1-[4-[tert-butyl(dimethyl)silyl]phenyl]-2-phenyl-2-azaspiro[3.5]nonane-3,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-[4-[tert-butyl(dimethyl)silyl]phenyl]-2-phenyl-2-azaspiro[3.5]nonane-3,7-dione?
The IUPAC name of (1R)-1-[4-[tert-butyl(dimethyl)silyl]phenyl]-2-phenyl-2-azaspiro[3.5]nonane-3,7-dione (CID 154525397) is (1R)-1-[4-[tert-butyl(dimethyl)silyl]phenyl]-2-phenyl-2-azaspiro[3.5]nonane-3,7-dione.
What is the SMILES notation for (1R)-1-[4-[tert-butyl(dimethyl)silyl]phenyl]-2-phenyl-2-azaspiro[3.5]nonane-3,7-dione?
The canonical SMILES for (1R)-1-[4-[tert-butyl(dimethyl)silyl]phenyl]-2-phenyl-2-azaspiro[3.5]nonane-3,7-dione is CC(C)(C)[Si](C)(C)c1ccc([C@H]2N(c3ccccc3)C(=O)C23CCC(=O)CC3)cc1.
What is the InChIKey of (1R)-1-[4-[tert-butyl(dimethyl)silyl]phenyl]-2-phenyl-2-azaspiro[3.5]nonane-3,7-dione?
The InChIKey is XWVDVVWDRZSKPE-HSZRJFAPSA-N. The full InChI is InChI=1S/C26H33NO2Si/c1-25(2,3)30(4,5)22-13-11-19(12-14-22)23-26(17-15-21(28)16-18-26)24(29)27(23)20-9-7-6-8-10-20/h6-14,23H,15-18H2,1-5H3/t23-/m1/s1.
What are the key properties of (1R)-1-[4-[tert-butyl(dimethyl)silyl]phenyl]-2-phenyl-2-azaspiro[3.5]nonane-3,7-dione?
(1R)-1-[4-[tert-butyl(dimethyl)silyl]phenyl]-2-phenyl-2-azaspiro[3.5]nonane-3,7-dione has a molecular weight of 419.64 g/mol, XLogP of 5.62, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-[4-[tert-butyl(dimethyl)silyl]phenyl]-2-phenyl-2-azaspiro[3.5]nonane-3,7-dione is sourced from PubChem (CID 154525397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).