About 3,3-dimethyl-N-[(1S)-1-(4-nitrophenyl)ethyl]-1,5-dioxecan-8-amine
3,3-dimethyl-N-[(1S)-1-(4-nitrophenyl)ethyl]-1,5-dioxecan-8-amine (PubChem CID 154525928) has the molecular formula C18H28N2O4
and a molecular weight of 336.43 g/mol. Its IUPAC name is 3,3-dimethyl-N-[(1S)-1-(4-nitrophenyl)ethyl]-1,5-dioxecan-8-amine.
Molecular Properties
| Compound Name | 3,3-dimethyl-N-[(1S)-1-(4-nitrophenyl)ethyl]-1,5-dioxecan-8-amine |
| PubChem CID | 154525928 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 3,3-dimethyl-N-[(1S)-1-(4-nitrophenyl)ethyl]-1,5-dioxecan-8-amine |
| SMILES | C[C@H](NC1CCOCC(C)(C)COCC1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H28N2O4/c1-14(15-4-6-17(7-5-15)20(21)22)19-16-8-10-23-12-18(2,3)13-24-11-9-16/h4-7,14,16,19H,8-13H2,1-3H3/t14-/m0/s1 |
| InChIKey | JYPDGICZVSMYPD-AWEZNQCLSA-N |
| XLogP | 3.47 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dimethyl-N-[(1S)-1-(4-nitrophenyl)ethyl]-1,5-dioxecan-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-N-[(1S)-1-(4-nitrophenyl)ethyl]-1,5-dioxecan-8-amine?
The IUPAC name of 3,3-dimethyl-N-[(1S)-1-(4-nitrophenyl)ethyl]-1,5-dioxecan-8-amine (CID 154525928) is 3,3-dimethyl-N-[(1S)-1-(4-nitrophenyl)ethyl]-1,5-dioxecan-8-amine.
What is the SMILES notation for 3,3-dimethyl-N-[(1S)-1-(4-nitrophenyl)ethyl]-1,5-dioxecan-8-amine?
The canonical SMILES for 3,3-dimethyl-N-[(1S)-1-(4-nitrophenyl)ethyl]-1,5-dioxecan-8-amine is C[C@H](NC1CCOCC(C)(C)COCC1)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 3,3-dimethyl-N-[(1S)-1-(4-nitrophenyl)ethyl]-1,5-dioxecan-8-amine?
The InChIKey is JYPDGICZVSMYPD-AWEZNQCLSA-N. The full InChI is InChI=1S/C18H28N2O4/c1-14(15-4-6-17(7-5-15)20(21)22)19-16-8-10-23-12-18(2,3)13-24-11-9-16/h4-7,14,16,19H,8-13H2,1-3H3/t14-/m0/s1.
What are the key properties of 3,3-dimethyl-N-[(1S)-1-(4-nitrophenyl)ethyl]-1,5-dioxecan-8-amine?
3,3-dimethyl-N-[(1S)-1-(4-nitrophenyl)ethyl]-1,5-dioxecan-8-amine has a molecular weight of 336.43 g/mol, XLogP of 3.47, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-N-[(1S)-1-(4-nitrophenyl)ethyl]-1,5-dioxecan-8-amine is sourced from PubChem (CID 154525928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).