About [4-[(3,5-dimethoxyphenyl)sulfamoyl]-2-methylphenyl] 2-(4-pyrrolidin-1-ylphenyl)butanoate
[4-[(3,5-dimethoxyphenyl)sulfamoyl]-2-methylphenyl] 2-(4-pyrrolidin-1-ylphenyl)butanoate (PubChem CID 154526179) has the molecular formula C29H34N2O6S
and a molecular weight of 538.67 g/mol. Its IUPAC name is [4-[(3,5-dimethoxyphenyl)sulfamoyl]-2-methylphenyl] 2-(4-pyrrolidin-1-ylphenyl)butanoate.
Molecular Properties
| Compound Name | [4-[(3,5-dimethoxyphenyl)sulfamoyl]-2-methylphenyl] 2-(4-pyrrolidin-1-ylphenyl)butanoate |
| PubChem CID | 154526179 |
| Molecular Formula | C29H34N2O6S |
| Molecular Weight | 538.67 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | [4-[(3,5-dimethoxyphenyl)sulfamoyl]-2-methylphenyl] 2-(4-pyrrolidin-1-ylphenyl)butanoate |
| SMILES | CCC(C(=O)Oc1ccc(S(=O)(=O)Nc2cc(OC)cc(OC)c2)cc1C)c1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C29H34N2O6S/c1-5-27(21-8-10-23(11-9-21)31-14-6-7-15-31)29(32)37-28-13-12-26(16-20(28)2)38(33,34)30-22-17-24(35-3)19-25(18-22)36-4/h8-13,16-19,27,30H,5-7,14-15H2,1-4H3 |
| InChIKey | JQSHUVCMEANNTD-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 538.67 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[(3,5-dimethoxyphenyl)sulfamoyl]-2-methylphenyl] 2-(4-pyrrolidin-1-ylphenyl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(3,5-dimethoxyphenyl)sulfamoyl]-2-methylphenyl] 2-(4-pyrrolidin-1-ylphenyl)butanoate?
The IUPAC name of [4-[(3,5-dimethoxyphenyl)sulfamoyl]-2-methylphenyl] 2-(4-pyrrolidin-1-ylphenyl)butanoate (CID 154526179) is [4-[(3,5-dimethoxyphenyl)sulfamoyl]-2-methylphenyl] 2-(4-pyrrolidin-1-ylphenyl)butanoate.
What is the SMILES notation for [4-[(3,5-dimethoxyphenyl)sulfamoyl]-2-methylphenyl] 2-(4-pyrrolidin-1-ylphenyl)butanoate?
The canonical SMILES for [4-[(3,5-dimethoxyphenyl)sulfamoyl]-2-methylphenyl] 2-(4-pyrrolidin-1-ylphenyl)butanoate is CCC(C(=O)Oc1ccc(S(=O)(=O)Nc2cc(OC)cc(OC)c2)cc1C)c1ccc(N2CCCC2)cc1.
What is the InChIKey of [4-[(3,5-dimethoxyphenyl)sulfamoyl]-2-methylphenyl] 2-(4-pyrrolidin-1-ylphenyl)butanoate?
The InChIKey is JQSHUVCMEANNTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H34N2O6S/c1-5-27(21-8-10-23(11-9-21)31-14-6-7-15-31)29(32)37-28-13-12-26(16-20(28)2)38(33,34)30-22-17-24(35-3)19-25(18-22)36-4/h8-13,16-19,27,30H,5-7,14-15H2,1-4H3.
What are the key properties of [4-[(3,5-dimethoxyphenyl)sulfamoyl]-2-methylphenyl] 2-(4-pyrrolidin-1-ylphenyl)butanoate?
[4-[(3,5-dimethoxyphenyl)sulfamoyl]-2-methylphenyl] 2-(4-pyrrolidin-1-ylphenyl)butanoate has a molecular weight of 538.67 g/mol, XLogP of 5.51, 10 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(3,5-dimethoxyphenyl)sulfamoyl]-2-methylphenyl] 2-(4-pyrrolidin-1-ylphenyl)butanoate is sourced from PubChem (CID 154526179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).