C22H25N5O3 — CID 154528197
methyl 3-[[(2R)-3-(3H-benzimidazol-5-yl)oxiran-2-yl]amino]-2-[(3-carbamimidoylphenyl)methyl]butanoate (PubChem CID 154528197) has the molecular formula C22H25N5O3 and a molecular weight of 407.47 g/mol. Its IUPAC name is methyl 3-[[(2R)-3-(3H-benzimidazol-5-yl)oxiran-2-yl]amino]-2-[(3-carbamimidoylphenyl)methyl]butanoate.
| Compound Name | methyl 3-[[(2R)-3-(3H-benzimidazol-5-yl)oxiran-2-yl]amino]-2-[(3-carbamimidoylphenyl)methyl]butanoate |
|---|---|
| PubChem CID | 154528197 |
| Molecular Formula | C22H25N5O3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | methyl 3-[[(2R)-3-(3H-benzimidazol-5-yl)oxiran-2-yl]amino]-2-[(3-carbamimidoylphenyl)methyl]butanoate |
| SMILES | [H]/N=C(\N)c1cccc(CC(C(=O)OC)C(C)N[C@@H]2OC2c2ccc3nc[nH]c3c2)c1 |
| InChI | InChI=1S/C22H25N5O3/c1-12(16(22(28)29-2)9-13-4-3-5-15(8-13)20(23)24)27-21-19(30-21)14-6-7-17-18(10-14)26-11-25-17/h3-8,10-12,16,19,21,27H,9H2,1-2H3,(H3,23,24)(H,25,26)/t12?,16?,19?,21-/m1/s1 |
| InChIKey | WXEKOKJCOWKCPE-HWZMMSAPSA-N |
| XLogP | 2.25 |
| TPSA | 129.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|