About CID 154529602
CID 154529602 (PubChem CID 154529602) has the molecular formula C11H12AlNO3
and a molecular weight of 233.20 g/mol.
Molecular Properties
| Compound Name | CID 154529602 |
| PubChem CID | 154529602 |
| Molecular Formula | C11H12AlNO3 |
| Molecular Weight | 233.20 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | — |
| SMILES | Cc1ccccc1C(=O)CCC([Al])[N+](=O)[O-] |
| InChI | InChI=1S/C11H12NO3.Al/c1-9-5-2-3-6-10(9)11(13)7-4-8-12(14)15;/h2-3,5-6,8H,4,7H2,1H3; |
| InChIKey | NFIAZPDTJRHXNA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.20 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 154529602 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 154529602?
The IUPAC name of CID 154529602 (CID 154529602) is not available.
What is the SMILES notation for CID 154529602?
The canonical SMILES for CID 154529602 is Cc1ccccc1C(=O)CCC([Al])[N+](=O)[O-].
What is the InChIKey of CID 154529602?
The InChIKey is NFIAZPDTJRHXNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12NO3.Al/c1-9-5-2-3-6-10(9)11(13)7-4-8-12(14)15;/h2-3,5-6,8H,4,7H2,1H3;.
What are the key properties of CID 154529602?
CID 154529602 has a molecular weight of 233.20 g/mol, XLogP of 1.73, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 154529602 is sourced from PubChem (CID 154529602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).