About N-[(1R,2S)-2-(2,7-dimethoxynaphthalen-1-yl)cyclopropyl]acetamide
N-[(1R,2S)-2-(2,7-dimethoxynaphthalen-1-yl)cyclopropyl]acetamide (PubChem CID 15453090) has the molecular formula C17H19NO3
and a molecular weight of 285.34 g/mol. Its IUPAC name is N-[(1R,2S)-2-(2,7-dimethoxynaphthalen-1-yl)cyclopropyl]acetamide.
Molecular Properties
| Compound Name | N-[(1R,2S)-2-(2,7-dimethoxynaphthalen-1-yl)cyclopropyl]acetamide |
| PubChem CID | 15453090 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | N-[(1R,2S)-2-(2,7-dimethoxynaphthalen-1-yl)cyclopropyl]acetamide |
| SMILES | COc1ccc2ccc(OC)c([C@@H]3C[C@H]3NC(C)=O)c2c1 |
| InChI | InChI=1S/C17H19NO3/c1-10(19)18-15-9-14(15)17-13-8-12(20-2)6-4-11(13)5-7-16(17)21-3/h4-8,14-15H,9H2,1-3H3,(H,18,19)/t14-,15-/m1/s1 |
| InChIKey | VJGODNYYEUTWJZ-HUUCEWRRSA-N |
| XLogP | 2.85 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(1R,2S)-2-(2,7-dimethoxynaphthalen-1-yl)cyclopropyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R,2S)-2-(2,7-dimethoxynaphthalen-1-yl)cyclopropyl]acetamide?
The IUPAC name of N-[(1R,2S)-2-(2,7-dimethoxynaphthalen-1-yl)cyclopropyl]acetamide (CID 15453090) is N-[(1R,2S)-2-(2,7-dimethoxynaphthalen-1-yl)cyclopropyl]acetamide.
What is the SMILES notation for N-[(1R,2S)-2-(2,7-dimethoxynaphthalen-1-yl)cyclopropyl]acetamide?
The canonical SMILES for N-[(1R,2S)-2-(2,7-dimethoxynaphthalen-1-yl)cyclopropyl]acetamide is COc1ccc2ccc(OC)c([C@@H]3C[C@H]3NC(C)=O)c2c1.
What is the InChIKey of N-[(1R,2S)-2-(2,7-dimethoxynaphthalen-1-yl)cyclopropyl]acetamide?
The InChIKey is VJGODNYYEUTWJZ-HUUCEWRRSA-N. The full InChI is InChI=1S/C17H19NO3/c1-10(19)18-15-9-14(15)17-13-8-12(20-2)6-4-11(13)5-7-16(17)21-3/h4-8,14-15H,9H2,1-3H3,(H,18,19)/t14-,15-/m1/s1.
What are the key properties of N-[(1R,2S)-2-(2,7-dimethoxynaphthalen-1-yl)cyclopropyl]acetamide?
N-[(1R,2S)-2-(2,7-dimethoxynaphthalen-1-yl)cyclopropyl]acetamide has a molecular weight of 285.34 g/mol, XLogP of 2.85, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R,2S)-2-(2,7-dimethoxynaphthalen-1-yl)cyclopropyl]acetamide is sourced from PubChem (CID 15453090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).