About 2,2-dimethyl-1,3-dihydroimidazole
2,2-dimethyl-1,3-dihydroimidazole (PubChem CID 154531295) has the molecular formula C5H10N2
and a molecular weight of 98.15 g/mol. Its IUPAC name is 2,2-dimethyl-1,3-dihydroimidazole.
Molecular Properties
| Compound Name | 2,2-dimethyl-1,3-dihydroimidazole |
| PubChem CID | 154531295 |
| Molecular Formula | C5H10N2 |
| Molecular Weight | 98.15 g/mol |
| Exact Mass | 98.08 |
| IUPAC Name | 2,2-dimethyl-1,3-dihydroimidazole |
| SMILES | CC1(C)NC=CN1 |
| InChI | InChI=1S/C5H10N2/c1-5(2)6-3-4-7-5/h3-4,6-7H,1-2H3 |
| InChIKey | BGXPTJASJGGKAJ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.15 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-dimethyl-1,3-dihydroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-1,3-dihydroimidazole?
The IUPAC name of 2,2-dimethyl-1,3-dihydroimidazole (CID 154531295) is 2,2-dimethyl-1,3-dihydroimidazole.
What is the SMILES notation for 2,2-dimethyl-1,3-dihydroimidazole?
The canonical SMILES for 2,2-dimethyl-1,3-dihydroimidazole is CC1(C)NC=CN1.
What is the InChIKey of 2,2-dimethyl-1,3-dihydroimidazole?
The InChIKey is BGXPTJASJGGKAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2/c1-5(2)6-3-4-7-5/h3-4,6-7H,1-2H3.
What are the key properties of 2,2-dimethyl-1,3-dihydroimidazole?
2,2-dimethyl-1,3-dihydroimidazole has a molecular weight of 98.15 g/mol, XLogP of 0.39, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-1,3-dihydroimidazole is sourced from PubChem (CID 154531295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).