About 1'-ethyl-2',2'-dimethylspiro[1H-indole-3,3'-pyrrolidine]-2-one
1'-ethyl-2',2'-dimethylspiro[1H-indole-3,3'-pyrrolidine]-2-one (PubChem CID 15453222) has the molecular formula C15H20N2O
and a molecular weight of 244.34 g/mol. Its IUPAC name is 1'-ethyl-2',2'-dimethylspiro[1H-indole-3,3'-pyrrolidine]-2-one.
Molecular Properties
| Compound Name | 1'-ethyl-2',2'-dimethylspiro[1H-indole-3,3'-pyrrolidine]-2-one |
| PubChem CID | 15453222 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 1'-ethyl-2',2'-dimethylspiro[1H-indole-3,3'-pyrrolidine]-2-one |
| SMILES | CCN1CCC2(C(=O)Nc3ccccc32)C1(C)C |
| InChI | InChI=1S/C15H20N2O/c1-4-17-10-9-15(14(17,2)3)11-7-5-6-8-12(11)16-13(15)18/h5-8H,4,9-10H2,1-3H3,(H,16,18) |
| InChIKey | LNIULSBHAMXNDY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1'-ethyl-2',2'-dimethylspiro[1H-indole-3,3'-pyrrolidine]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-ethyl-2',2'-dimethylspiro[1H-indole-3,3'-pyrrolidine]-2-one?
The IUPAC name of 1'-ethyl-2',2'-dimethylspiro[1H-indole-3,3'-pyrrolidine]-2-one (CID 15453222) is 1'-ethyl-2',2'-dimethylspiro[1H-indole-3,3'-pyrrolidine]-2-one.
What is the SMILES notation for 1'-ethyl-2',2'-dimethylspiro[1H-indole-3,3'-pyrrolidine]-2-one?
The canonical SMILES for 1'-ethyl-2',2'-dimethylspiro[1H-indole-3,3'-pyrrolidine]-2-one is CCN1CCC2(C(=O)Nc3ccccc32)C1(C)C.
What is the InChIKey of 1'-ethyl-2',2'-dimethylspiro[1H-indole-3,3'-pyrrolidine]-2-one?
The InChIKey is LNIULSBHAMXNDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O/c1-4-17-10-9-15(14(17,2)3)11-7-5-6-8-12(11)16-13(15)18/h5-8H,4,9-10H2,1-3H3,(H,16,18).
What are the key properties of 1'-ethyl-2',2'-dimethylspiro[1H-indole-3,3'-pyrrolidine]-2-one?
1'-ethyl-2',2'-dimethylspiro[1H-indole-3,3'-pyrrolidine]-2-one has a molecular weight of 244.34 g/mol, XLogP of 2.38, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-ethyl-2',2'-dimethylspiro[1H-indole-3,3'-pyrrolidine]-2-one is sourced from PubChem (CID 15453222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).