C11H12F6O2S — CID 154534439
5-(1,1,1,3,3,3-hexafluoro-2-methylsulfonylpropan-2-yl)bicyclo[2.2.1]hept-2-ene (PubChem CID 154534439) has the molecular formula C11H12F6O2S and a molecular weight of 322.27 g/mol. Its IUPAC name is 5-(1,1,1,3,3,3-hexafluoro-2-methylsulfonylpropan-2-yl)bicyclo[2.2.1]hept-2-ene.
| Compound Name | 5-(1,1,1,3,3,3-hexafluoro-2-methylsulfonylpropan-2-yl)bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 154534439 |
| Molecular Formula | C11H12F6O2S |
| Molecular Weight | 322.27 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 5-(1,1,1,3,3,3-hexafluoro-2-methylsulfonylpropan-2-yl)bicyclo[2.2.1]hept-2-ene |
| SMILES | CS(=O)(=O)C(C1CC2C=CC1C2)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H12F6O2S/c1-20(18,19)9(10(12,13)14,11(15,16)17)8-5-6-2-3-7(8)4-6/h2-3,6-8H,4-5H2,1H3 |
| InChIKey | XILWMPRJBTVXKC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.27 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|