C28H25F3N6O4 — CID 154536030
[4-[7-but-2-ynyl-1-methyl-2,6-dioxo-3-(4-phenylphenyl)purin-8-yl]piperazin-1-yl] 2,2,2-trifluoroacetate (PubChem CID 154536030) has the molecular formula C28H25F3N6O4 and a molecular weight of 566.54 g/mol. Its IUPAC name is [4-[7-but-2-ynyl-1-methyl-2,6-dioxo-3-(4-phenylphenyl)purin-8-yl]piperazin-1-yl] 2,2,2-trifluoroacetate.
| Compound Name | [4-[7-but-2-ynyl-1-methyl-2,6-dioxo-3-(4-phenylphenyl)purin-8-yl]piperazin-1-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 154536030 |
| Molecular Formula | C28H25F3N6O4 |
| Molecular Weight | 566.54 g/mol |
| Exact Mass | 566.19 |
| IUPAC Name | [4-[7-but-2-ynyl-1-methyl-2,6-dioxo-3-(4-phenylphenyl)purin-8-yl]piperazin-1-yl] 2,2,2-trifluoroacetate |
| SMILES | CC#CCn1c(N2CCN(OC(=O)C(F)(F)F)CC2)nc2c1c(=O)n(C)c(=O)n2-c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H25F3N6O4/c1-3-4-14-36-22-23(32-26(36)34-15-17-35(18-16-34)41-25(39)28(29,30)31)37(27(40)33(2)24(22)38)21-12-10-20(11-13-21)19-8-6-5-7-9-19/h5-13H,14-18H2,1-2H3 |
| InChIKey | PUCZYGZMJQDKMZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 94.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.54 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|