About (2R)-2,5-dimethyl-2,5-dihydrofuran
(2R)-2,5-dimethyl-2,5-dihydrofuran (PubChem CID 154537787) has the molecular formula C6H10O
and a molecular weight of 98.14 g/mol. Its IUPAC name is (2R)-2,5-dimethyl-2,5-dihydrofuran.
Molecular Properties
| Compound Name | (2R)-2,5-dimethyl-2,5-dihydrofuran |
| PubChem CID | 154537787 |
| Molecular Formula | C6H10O |
| Molecular Weight | 98.14 g/mol |
| Exact Mass | 98.07 |
| IUPAC Name | (2R)-2,5-dimethyl-2,5-dihydrofuran |
| SMILES | CC1C=C[C@@H](C)O1 |
| InChI | InChI=1S/C6H10O/c1-5-3-4-6(2)7-5/h3-6H,1-2H3/t5-,6?/m1/s1 |
| InChIKey | UZYVJMDRMHWAPX-LWOQYNTDSA-N |
| XLogP | 1.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.14 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2,5-dimethyl-2,5-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2,5-dimethyl-2,5-dihydrofuran?
The IUPAC name of (2R)-2,5-dimethyl-2,5-dihydrofuran (CID 154537787) is (2R)-2,5-dimethyl-2,5-dihydrofuran.
What is the SMILES notation for (2R)-2,5-dimethyl-2,5-dihydrofuran?
The canonical SMILES for (2R)-2,5-dimethyl-2,5-dihydrofuran is CC1C=C[C@@H](C)O1.
What is the InChIKey of (2R)-2,5-dimethyl-2,5-dihydrofuran?
The InChIKey is UZYVJMDRMHWAPX-LWOQYNTDSA-N. The full InChI is InChI=1S/C6H10O/c1-5-3-4-6(2)7-5/h3-6H,1-2H3/t5-,6?/m1/s1.
What are the key properties of (2R)-2,5-dimethyl-2,5-dihydrofuran?
(2R)-2,5-dimethyl-2,5-dihydrofuran has a molecular weight of 98.14 g/mol, XLogP of 1.35, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2,5-dimethyl-2,5-dihydrofuran is sourced from PubChem (CID 154537787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).