C35H42N6O3 — CID 15453791
N-[4-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]butyl]-4-[2-(dimethylamino)ethoxy-phenylmethyl]benzamide (PubChem CID 15453791) has the molecular formula C35H42N6O3 and a molecular weight of 594.76 g/mol. Its IUPAC name is N-[4-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]butyl]-4-[2-(dimethylamino)ethoxy-phenylmethyl]benzamide.
| Compound Name | N-[4-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]butyl]-4-[2-(dimethylamino)ethoxy-phenylmethyl]benzamide |
|---|---|
| PubChem CID | 15453791 |
| Molecular Formula | C35H42N6O3 |
| Molecular Weight | 594.76 g/mol |
| Exact Mass | 594.33 |
| IUPAC Name | N-[4-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]butyl]-4-[2-(dimethylamino)ethoxy-phenylmethyl]benzamide |
| SMILES | CCOCc1nc2c(N)nc3ccccc3c2n1CCCCNC(=O)c1ccc(C(OCCN(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C35H42N6O3/c1-4-43-24-30-39-31-32(28-14-8-9-15-29(28)38-34(31)36)41(30)21-11-10-20-37-35(42)27-18-16-26(17-19-27)33(44-23-22-40(2)3)25-12-6-5-7-13-25/h5-9,12-19,33H,4,10-11,20-24H2,1-3H3,(H2,36,38)(H,37,42) |
| InChIKey | UNUUVKHQZFECNR-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.76 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|