About 4-methylsulfonyl-N'-phenylbenzohydrazide
4-methylsulfonyl-N'-phenylbenzohydrazide (PubChem CID 15453816) has the molecular formula C14H14N2O3S
and a molecular weight of 290.34 g/mol. Its IUPAC name is 4-methylsulfonyl-N'-phenylbenzohydrazide.
Molecular Properties
| Compound Name | 4-methylsulfonyl-N'-phenylbenzohydrazide |
| PubChem CID | 15453816 |
| Molecular Formula | C14H14N2O3S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 4-methylsulfonyl-N'-phenylbenzohydrazide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)NNc2ccccc2)cc1 |
| InChI | InChI=1S/C14H14N2O3S/c1-20(18,19)13-9-7-11(8-10-13)14(17)16-15-12-5-3-2-4-6-12/h2-10,15H,1H3,(H,16,17) |
| InChIKey | IXLSNLODGURDCN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methylsulfonyl-N'-phenylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylsulfonyl-N'-phenylbenzohydrazide?
The IUPAC name of 4-methylsulfonyl-N'-phenylbenzohydrazide (CID 15453816) is 4-methylsulfonyl-N'-phenylbenzohydrazide.
What is the SMILES notation for 4-methylsulfonyl-N'-phenylbenzohydrazide?
The canonical SMILES for 4-methylsulfonyl-N'-phenylbenzohydrazide is CS(=O)(=O)c1ccc(C(=O)NNc2ccccc2)cc1.
What is the InChIKey of 4-methylsulfonyl-N'-phenylbenzohydrazide?
The InChIKey is IXLSNLODGURDCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O3S/c1-20(18,19)13-9-7-11(8-10-13)14(17)16-15-12-5-3-2-4-6-12/h2-10,15H,1H3,(H,16,17).
What are the key properties of 4-methylsulfonyl-N'-phenylbenzohydrazide?
4-methylsulfonyl-N'-phenylbenzohydrazide has a molecular weight of 290.34 g/mol, XLogP of 1.85, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylsulfonyl-N'-phenylbenzohydrazide is sourced from PubChem (CID 15453816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).