C13H17NO — CID 15453852
7-methoxy-4-phenyl-3,4,5,6-tetrahydro-2H-azepine (PubChem CID 15453852) has the molecular formula C13H17NO and a molecular weight of 203.29 g/mol. Its IUPAC name is 7-methoxy-4-phenyl-3,4,5,6-tetrahydro-2H-azepine.
| Compound Name | 7-methoxy-4-phenyl-3,4,5,6-tetrahydro-2H-azepine |
|---|---|
| PubChem CID | 15453852 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 7-methoxy-4-phenyl-3,4,5,6-tetrahydro-2H-azepine |
| SMILES | COC1=NCCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C13H17NO/c1-15-13-8-7-12(9-10-14-13)11-5-3-2-4-6-11/h2-6,12H,7-10H2,1H3 |
| InChIKey | RCNQYWMDRQHQRH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |