C22H24N8O — CID 154539551
2-(furan-2-yl)-8-methanimidoyl-7-N-[2-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)ethyl]-[1,2,4]triazolo[1,5-c]pyrimidine-5,7-diamine (PubChem CID 154539551) has the molecular formula C22H24N8O and a molecular weight of 416.49 g/mol. Its IUPAC name is 2-(furan-2-yl)-8-methanimidoyl-7-N-[2-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)ethyl]-[1,2,4]triazolo[1,5-c]pyrimidine-5,7-diamine.
| Compound Name | 2-(furan-2-yl)-8-methanimidoyl-7-N-[2-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)ethyl]-[1,2,4]triazolo[1,5-c]pyrimidine-5,7-diamine |
|---|---|
| PubChem CID | 154539551 |
| Molecular Formula | C22H24N8O |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 2-(furan-2-yl)-8-methanimidoyl-7-N-[2-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)ethyl]-[1,2,4]triazolo[1,5-c]pyrimidine-5,7-diamine |
| SMILES | [H]/N=C/c1c(NCCN2CCc3ccccc3CC2)nc(N)n2nc(-c3ccco3)nc12 |
| InChI | InChI=1S/C22H24N8O/c23-14-17-19(25-9-12-29-10-7-15-4-1-2-5-16(15)8-11-29)27-22(24)30-21(17)26-20(28-30)18-6-3-13-31-18/h1-6,13-14,23,25H,7-12H2,(H2,24,27)/b23-14+ |
| InChIKey | FADVFQPLKUDONG-OEAKJJBVSA-N |
| XLogP | 2.48 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|