About 3-chloro-5-methoxy-1,2-benzoxazole
3-chloro-5-methoxy-1,2-benzoxazole (PubChem CID 15453987) has the molecular formula C8H6ClNO2
and a molecular weight of 183.59 g/mol. Its IUPAC name is 3-chloro-5-methoxy-1,2-benzoxazole.
Molecular Properties
| Compound Name | 3-chloro-5-methoxy-1,2-benzoxazole |
| PubChem CID | 15453987 |
| Molecular Formula | C8H6ClNO2 |
| Molecular Weight | 183.59 g/mol |
| Exact Mass | 183.01 |
| IUPAC Name | 3-chloro-5-methoxy-1,2-benzoxazole |
| SMILES | COc1ccc2onc(Cl)c2c1 |
| InChI | InChI=1S/C8H6ClNO2/c1-11-5-2-3-7-6(4-5)8(9)10-12-7/h2-4H,1H3 |
| InChIKey | WWUNEEPZIRSXPD-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.59 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-chloro-5-methoxy-1,2-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-5-methoxy-1,2-benzoxazole?
The IUPAC name of 3-chloro-5-methoxy-1,2-benzoxazole (CID 15453987) is 3-chloro-5-methoxy-1,2-benzoxazole.
What is the SMILES notation for 3-chloro-5-methoxy-1,2-benzoxazole?
The canonical SMILES for 3-chloro-5-methoxy-1,2-benzoxazole is COc1ccc2onc(Cl)c2c1.
What is the InChIKey of 3-chloro-5-methoxy-1,2-benzoxazole?
The InChIKey is WWUNEEPZIRSXPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClNO2/c1-11-5-2-3-7-6(4-5)8(9)10-12-7/h2-4H,1H3.
What are the key properties of 3-chloro-5-methoxy-1,2-benzoxazole?
3-chloro-5-methoxy-1,2-benzoxazole has a molecular weight of 183.59 g/mol, XLogP of 2.49, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-5-methoxy-1,2-benzoxazole is sourced from PubChem (CID 15453987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).