About 2-(3-methylbutyl)-4,5-dihydro-1H-imidazole
2-(3-methylbutyl)-4,5-dihydro-1H-imidazole (PubChem CID 15454014) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol. Its IUPAC name is 2-(3-methylbutyl)-4,5-dihydro-1H-imidazole.
Molecular Properties
| Compound Name | 2-(3-methylbutyl)-4,5-dihydro-1H-imidazole |
| PubChem CID | 15454014 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | 2-(3-methylbutyl)-4,5-dihydro-1H-imidazole |
| SMILES | CC(C)CCC1=NCCN1 |
| InChI | InChI=1S/C8H16N2/c1-7(2)3-4-8-9-5-6-10-8/h7H,3-6H2,1-2H3,(H,9,10) |
| InChIKey | ACKFOKKSGWRNAD-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3-methylbutyl)-4,5-dihydro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methylbutyl)-4,5-dihydro-1H-imidazole?
The IUPAC name of 2-(3-methylbutyl)-4,5-dihydro-1H-imidazole (CID 15454014) is 2-(3-methylbutyl)-4,5-dihydro-1H-imidazole.
What is the SMILES notation for 2-(3-methylbutyl)-4,5-dihydro-1H-imidazole?
The canonical SMILES for 2-(3-methylbutyl)-4,5-dihydro-1H-imidazole is CC(C)CCC1=NCCN1.
What is the InChIKey of 2-(3-methylbutyl)-4,5-dihydro-1H-imidazole?
The InChIKey is ACKFOKKSGWRNAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2/c1-7(2)3-4-8-9-5-6-10-8/h7H,3-6H2,1-2H3,(H,9,10).
What are the key properties of 2-(3-methylbutyl)-4,5-dihydro-1H-imidazole?
2-(3-methylbutyl)-4,5-dihydro-1H-imidazole has a molecular weight of 140.23 g/mol, XLogP of 1.42, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methylbutyl)-4,5-dihydro-1H-imidazole is sourced from PubChem (CID 15454014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).