About 2,3-dimethyl-4-(trifluoromethyl)cyclohexa-1,5-dien-1-amine
2,3-dimethyl-4-(trifluoromethyl)cyclohexa-1,5-dien-1-amine (PubChem CID 154544220) has the molecular formula C9H12F3N
and a molecular weight of 191.20 g/mol. Its IUPAC name is 2,3-dimethyl-4-(trifluoromethyl)cyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | 2,3-dimethyl-4-(trifluoromethyl)cyclohexa-1,5-dien-1-amine |
| PubChem CID | 154544220 |
| Molecular Formula | C9H12F3N |
| Molecular Weight | 191.20 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 2,3-dimethyl-4-(trifluoromethyl)cyclohexa-1,5-dien-1-amine |
| SMILES | CC1=C(N)C=CC(C(F)(F)F)C1C |
| InChI | InChI=1S/C9H12F3N/c1-5-6(2)8(13)4-3-7(5)9(10,11)12/h3-5,7H,13H2,1-2H3 |
| InChIKey | ZXATZVATDSUJAS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.20 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3-dimethyl-4-(trifluoromethyl)cyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-4-(trifluoromethyl)cyclohexa-1,5-dien-1-amine?
The IUPAC name of 2,3-dimethyl-4-(trifluoromethyl)cyclohexa-1,5-dien-1-amine (CID 154544220) is 2,3-dimethyl-4-(trifluoromethyl)cyclohexa-1,5-dien-1-amine.
What is the SMILES notation for 2,3-dimethyl-4-(trifluoromethyl)cyclohexa-1,5-dien-1-amine?
The canonical SMILES for 2,3-dimethyl-4-(trifluoromethyl)cyclohexa-1,5-dien-1-amine is CC1=C(N)C=CC(C(F)(F)F)C1C.
What is the InChIKey of 2,3-dimethyl-4-(trifluoromethyl)cyclohexa-1,5-dien-1-amine?
The InChIKey is ZXATZVATDSUJAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F3N/c1-5-6(2)8(13)4-3-7(5)9(10,11)12/h3-5,7H,13H2,1-2H3.
What are the key properties of 2,3-dimethyl-4-(trifluoromethyl)cyclohexa-1,5-dien-1-amine?
2,3-dimethyl-4-(trifluoromethyl)cyclohexa-1,5-dien-1-amine has a molecular weight of 191.20 g/mol, XLogP of 2.60, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-4-(trifluoromethyl)cyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 154544220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).