C18H20ClN5O4S2 — CID 154544953
4-chloro-2-[[4-[(5-methylfuran-2-yl)methylamino]-1,2,5-thiadiazol-3-yl]amino]-6-pyrrolidin-1-ylsulfonylphenol (PubChem CID 154544953) has the molecular formula C18H20ClN5O4S2 and a molecular weight of 469.98 g/mol. Its IUPAC name is 4-chloro-2-[[4-[(5-methylfuran-2-yl)methylamino]-1,2,5-thiadiazol-3-yl]amino]-6-pyrrolidin-1-ylsulfonylphenol.
| Compound Name | 4-chloro-2-[[4-[(5-methylfuran-2-yl)methylamino]-1,2,5-thiadiazol-3-yl]amino]-6-pyrrolidin-1-ylsulfonylphenol |
|---|---|
| PubChem CID | 154544953 |
| Molecular Formula | C18H20ClN5O4S2 |
| Molecular Weight | 469.98 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | 4-chloro-2-[[4-[(5-methylfuran-2-yl)methylamino]-1,2,5-thiadiazol-3-yl]amino]-6-pyrrolidin-1-ylsulfonylphenol |
| SMILES | Cc1ccc(CNc2nsnc2Nc2cc(Cl)cc(S(=O)(=O)N3CCCC3)c2O)o1 |
| InChI | InChI=1S/C18H20ClN5O4S2/c1-11-4-5-13(28-11)10-20-17-18(23-29-22-17)21-14-8-12(19)9-15(16(14)25)30(26,27)24-6-2-3-7-24/h4-5,8-9,25H,2-3,6-7,10H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | DPEKRDQZHJMKQN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 120.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.98 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|