About 2-fluoro-3-isothiocyanato-5-(trifluoromethyl)cyclohexa-1,3-diene
2-fluoro-3-isothiocyanato-5-(trifluoromethyl)cyclohexa-1,3-diene (PubChem CID 154545496) has the molecular formula C8H5F4NS
and a molecular weight of 223.19 g/mol. Its IUPAC name is 2-fluoro-3-isothiocyanato-5-(trifluoromethyl)cyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 2-fluoro-3-isothiocyanato-5-(trifluoromethyl)cyclohexa-1,3-diene |
| PubChem CID | 154545496 |
| Molecular Formula | C8H5F4NS |
| Molecular Weight | 223.19 g/mol |
| Exact Mass | 223.01 |
| IUPAC Name | 2-fluoro-3-isothiocyanato-5-(trifluoromethyl)cyclohexa-1,3-diene |
| SMILES | FC1=CCC(C(F)(F)F)C=C1N=C=S |
| InChI | InChI=1S/C8H5F4NS/c9-6-2-1-5(8(10,11)12)3-7(6)13-4-14/h2-3,5H,1H2 |
| InChIKey | LGFQOGMCQJOIAF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.19 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-3-isothiocyanato-5-(trifluoromethyl)cyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-3-isothiocyanato-5-(trifluoromethyl)cyclohexa-1,3-diene?
The IUPAC name of 2-fluoro-3-isothiocyanato-5-(trifluoromethyl)cyclohexa-1,3-diene (CID 154545496) is 2-fluoro-3-isothiocyanato-5-(trifluoromethyl)cyclohexa-1,3-diene.
What is the SMILES notation for 2-fluoro-3-isothiocyanato-5-(trifluoromethyl)cyclohexa-1,3-diene?
The canonical SMILES for 2-fluoro-3-isothiocyanato-5-(trifluoromethyl)cyclohexa-1,3-diene is FC1=CCC(C(F)(F)F)C=C1N=C=S.
What is the InChIKey of 2-fluoro-3-isothiocyanato-5-(trifluoromethyl)cyclohexa-1,3-diene?
The InChIKey is LGFQOGMCQJOIAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5F4NS/c9-6-2-1-5(8(10,11)12)3-7(6)13-4-14/h2-3,5H,1H2.
What are the key properties of 2-fluoro-3-isothiocyanato-5-(trifluoromethyl)cyclohexa-1,3-diene?
2-fluoro-3-isothiocyanato-5-(trifluoromethyl)cyclohexa-1,3-diene has a molecular weight of 223.19 g/mol, XLogP of 3.41, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-3-isothiocyanato-5-(trifluoromethyl)cyclohexa-1,3-diene is sourced from PubChem (CID 154545496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).