About 1-[(2S)-2-acetylpyrrolidin-1-yl]-2-cyclohexa-1,3-dien-1-yl-2,2-difluoroethanone
1-[(2S)-2-acetylpyrrolidin-1-yl]-2-cyclohexa-1,3-dien-1-yl-2,2-difluoroethanone (PubChem CID 154545807) has the molecular formula C14H17F2NO2
and a molecular weight of 269.29 g/mol. Its IUPAC name is 1-[(2S)-2-acetylpyrrolidin-1-yl]-2-cyclohexa-1,3-dien-1-yl-2,2-difluoroethanone.
Molecular Properties
| Compound Name | 1-[(2S)-2-acetylpyrrolidin-1-yl]-2-cyclohexa-1,3-dien-1-yl-2,2-difluoroethanone |
| PubChem CID | 154545807 |
| Molecular Formula | C14H17F2NO2 |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 1-[(2S)-2-acetylpyrrolidin-1-yl]-2-cyclohexa-1,3-dien-1-yl-2,2-difluoroethanone |
| SMILES | CC(=O)[C@@H]1CCCN1C(=O)C(F)(F)C1=CC=CCC1 |
| InChI | InChI=1S/C14H17F2NO2/c1-10(18)12-8-5-9-17(12)13(19)14(15,16)11-6-3-2-4-7-11/h2-3,6,12H,4-5,7-9H2,1H3/t12-/m0/s1 |
| InChIKey | AAYONVJPHSJDLC-LBPRGKRZSA-N |
| XLogP | 2.48 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(2S)-2-acetylpyrrolidin-1-yl]-2-cyclohexa-1,3-dien-1-yl-2,2-difluoroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S)-2-acetylpyrrolidin-1-yl]-2-cyclohexa-1,3-dien-1-yl-2,2-difluoroethanone?
The IUPAC name of 1-[(2S)-2-acetylpyrrolidin-1-yl]-2-cyclohexa-1,3-dien-1-yl-2,2-difluoroethanone (CID 154545807) is 1-[(2S)-2-acetylpyrrolidin-1-yl]-2-cyclohexa-1,3-dien-1-yl-2,2-difluoroethanone.
What is the SMILES notation for 1-[(2S)-2-acetylpyrrolidin-1-yl]-2-cyclohexa-1,3-dien-1-yl-2,2-difluoroethanone?
The canonical SMILES for 1-[(2S)-2-acetylpyrrolidin-1-yl]-2-cyclohexa-1,3-dien-1-yl-2,2-difluoroethanone is CC(=O)[C@@H]1CCCN1C(=O)C(F)(F)C1=CC=CCC1.
What is the InChIKey of 1-[(2S)-2-acetylpyrrolidin-1-yl]-2-cyclohexa-1,3-dien-1-yl-2,2-difluoroethanone?
The InChIKey is AAYONVJPHSJDLC-LBPRGKRZSA-N. The full InChI is InChI=1S/C14H17F2NO2/c1-10(18)12-8-5-9-17(12)13(19)14(15,16)11-6-3-2-4-7-11/h2-3,6,12H,4-5,7-9H2,1H3/t12-/m0/s1.
What are the key properties of 1-[(2S)-2-acetylpyrrolidin-1-yl]-2-cyclohexa-1,3-dien-1-yl-2,2-difluoroethanone?
1-[(2S)-2-acetylpyrrolidin-1-yl]-2-cyclohexa-1,3-dien-1-yl-2,2-difluoroethanone has a molecular weight of 269.29 g/mol, XLogP of 2.48, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S)-2-acetylpyrrolidin-1-yl]-2-cyclohexa-1,3-dien-1-yl-2,2-difluoroethanone is sourced from PubChem (CID 154545807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).