C23H41N3O7 — CID 154546269
1-[2-hydroxy-3-[5-(2-hydroxybutoxy)-2,2,4,4-tetramethylpentoxy]propyl]-3-methyl-5-prop-2-enyl-1,3,5-triazinane-2,4,6-trione (PubChem CID 154546269) has the molecular formula C23H41N3O7 and a molecular weight of 471.60 g/mol. Its IUPAC name is 1-[2-hydroxy-3-[5-(2-hydroxybutoxy)-2,2,4,4-tetramethylpentoxy]propyl]-3-methyl-5-prop-2-enyl-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-[2-hydroxy-3-[5-(2-hydroxybutoxy)-2,2,4,4-tetramethylpentoxy]propyl]-3-methyl-5-prop-2-enyl-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 154546269 |
| Molecular Formula | C23H41N3O7 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.29 |
| IUPAC Name | 1-[2-hydroxy-3-[5-(2-hydroxybutoxy)-2,2,4,4-tetramethylpentoxy]propyl]-3-methyl-5-prop-2-enyl-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=CCn1c(=O)n(C)c(=O)n(CC(O)COCC(C)(C)CC(C)(C)COCC(O)CC)c1=O |
| InChI | InChI=1S/C23H41N3O7/c1-8-10-25-19(29)24(7)20(30)26(21(25)31)11-18(28)13-33-16-23(5,6)14-22(3,4)15-32-12-17(27)9-2/h8,17-18,27-28H,1,9-16H2,2-7H3 |
| InChIKey | FFECDRSCZPJDKK-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 124.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|