C17H24F6 — CID 154548918
3-[1,1,1,3,3,3-hexafluoro-2-(4-methylcyclohexyl)propan-2-yl]-6-methylcyclohexene (PubChem CID 154548918) has the molecular formula C17H24F6 and a molecular weight of 342.37 g/mol. Its IUPAC name is 3-[1,1,1,3,3,3-hexafluoro-2-(4-methylcyclohexyl)propan-2-yl]-6-methylcyclohexene.
| Compound Name | 3-[1,1,1,3,3,3-hexafluoro-2-(4-methylcyclohexyl)propan-2-yl]-6-methylcyclohexene |
|---|---|
| PubChem CID | 154548918 |
| Molecular Formula | C17H24F6 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 3-[1,1,1,3,3,3-hexafluoro-2-(4-methylcyclohexyl)propan-2-yl]-6-methylcyclohexene |
| SMILES | CC1C=CC(C(C2CCC(C)CC2)(C(F)(F)F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C17H24F6/c1-11-3-7-13(8-4-11)15(16(18,19)20,17(21,22)23)14-9-5-12(2)6-10-14/h3,7,11-14H,4-6,8-10H2,1-2H3 |
| InChIKey | DQPXYTJEOGWBOH-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|