C23H22F3N3O4S — CID 154549481
[4-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-yl]piperidin-1-yl]-[2-(2,2,2-trifluoroethoxy)-1H-pyrrol-3-yl]methanone (PubChem CID 154549481) has the molecular formula C23H22F3N3O4S and a molecular weight of 493.51 g/mol. Its IUPAC name is [4-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-yl]piperidin-1-yl]-[2-(2,2,2-trifluoroethoxy)-1H-pyrrol-3-yl]methanone.
| Compound Name | [4-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-yl]piperidin-1-yl]-[2-(2,2,2-trifluoroethoxy)-1H-pyrrol-3-yl]methanone |
|---|---|
| PubChem CID | 154549481 |
| Molecular Formula | C23H22F3N3O4S |
| Molecular Weight | 493.51 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | [4-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-yl]piperidin-1-yl]-[2-(2,2,2-trifluoroethoxy)-1H-pyrrol-3-yl]methanone |
| SMILES | O=C(c1cc[nH]c1OCC(F)(F)F)N1CCC(c2nc(-c3ccc4c(c3)OCCO4)cs2)CC1 |
| InChI | InChI=1S/C23H22F3N3O4S/c24-23(25,26)13-33-20-16(3-6-27-20)22(30)29-7-4-14(5-8-29)21-28-17(12-34-21)15-1-2-18-19(11-15)32-10-9-31-18/h1-3,6,11-12,14,27H,4-5,7-10,13H2 |
| InChIKey | DZHGYSZBIIEUKE-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.51 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |