C22H23F5N3O4PS — CID 154549729
1-[4-(1,1-difluoro-1-phosphanylpropan-2-yl)oxy-3-[4-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperazine-1-carbonyl]phenyl]butane-2,3-dione (PubChem CID 154549729) has the molecular formula C22H23F5N3O4PS and a molecular weight of 551.47 g/mol. Its IUPAC name is 1-[4-(1,1-difluoro-1-phosphanylpropan-2-yl)oxy-3-[4-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperazine-1-carbonyl]phenyl]butane-2,3-dione.
| Compound Name | 1-[4-(1,1-difluoro-1-phosphanylpropan-2-yl)oxy-3-[4-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperazine-1-carbonyl]phenyl]butane-2,3-dione |
|---|---|
| PubChem CID | 154549729 |
| Molecular Formula | C22H23F5N3O4PS |
| Molecular Weight | 551.47 g/mol |
| Exact Mass | 551.11 |
| IUPAC Name | 1-[4-(1,1-difluoro-1-phosphanylpropan-2-yl)oxy-3-[4-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperazine-1-carbonyl]phenyl]butane-2,3-dione |
| SMILES | CC(=O)C(=O)Cc1ccc(OC(C)C(F)(F)P)c(C(=O)N2CCN(c3nc(C(F)(F)F)cs3)CC2)c1 |
| InChI | InChI=1S/C22H23F5N3O4PS/c1-12(31)16(32)10-14-3-4-17(34-13(2)22(26,27)35)15(9-14)19(33)29-5-7-30(8-6-29)20-28-18(11-36-20)21(23,24)25/h3-4,9,11,13H,5-8,10,35H2,1-2H3 |
| InChIKey | VPHCHIXRTPRXGN-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|