About 6,6-dimethylpyrido[2,3-b]azepine
6,6-dimethylpyrido[2,3-b]azepine (PubChem CID 154549840) has the molecular formula C11H12N2
and a molecular weight of 172.23 g/mol. Its IUPAC name is 6,6-dimethylpyrido[2,3-b]azepine.
Molecular Properties
| Compound Name | 6,6-dimethylpyrido[2,3-b]azepine |
| PubChem CID | 154549840 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 6,6-dimethylpyrido[2,3-b]azepine |
| SMILES | CC1(C)C=CN=c2ncccc2=C1 |
| InChI | InChI=1S/C11H12N2/c1-11(2)5-7-13-10-9(8-11)4-3-6-12-10/h3-8H,1-2H3 |
| InChIKey | WMVKXADFNRFNAA-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,6-dimethylpyrido[2,3-b]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethylpyrido[2,3-b]azepine?
The IUPAC name of 6,6-dimethylpyrido[2,3-b]azepine (CID 154549840) is 6,6-dimethylpyrido[2,3-b]azepine.
What is the SMILES notation for 6,6-dimethylpyrido[2,3-b]azepine?
The canonical SMILES for 6,6-dimethylpyrido[2,3-b]azepine is CC1(C)C=CN=c2ncccc2=C1.
What is the InChIKey of 6,6-dimethylpyrido[2,3-b]azepine?
The InChIKey is WMVKXADFNRFNAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2/c1-11(2)5-7-13-10-9(8-11)4-3-6-12-10/h3-8H,1-2H3.
What are the key properties of 6,6-dimethylpyrido[2,3-b]azepine?
6,6-dimethylpyrido[2,3-b]azepine has a molecular weight of 172.23 g/mol, XLogP of 1.04, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethylpyrido[2,3-b]azepine is sourced from PubChem (CID 154549840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).