About 1-methyl-2-propylazirine
1-methyl-2-propylazirine (PubChem CID 154550384) has the molecular formula C6H11N
and a molecular weight of 97.16 g/mol. Its IUPAC name is 1-methyl-2-propylazirine.
Molecular Properties
| Compound Name | 1-methyl-2-propylazirine |
| PubChem CID | 154550384 |
| Molecular Formula | C6H11N |
| Molecular Weight | 97.16 g/mol |
| Exact Mass | 97.09 |
| IUPAC Name | 1-methyl-2-propylazirine |
| SMILES | CCCC1=CN1C |
| InChI | InChI=1S/C6H11N/c1-3-4-6-5-7(6)2/h5H,3-4H2,1-2H3 |
| InChIKey | JXRLSNVCELXOTA-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 97.16 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methyl-2-propylazirine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-propylazirine?
The IUPAC name of 1-methyl-2-propylazirine (CID 154550384) is 1-methyl-2-propylazirine.
What is the SMILES notation for 1-methyl-2-propylazirine?
The canonical SMILES for 1-methyl-2-propylazirine is CCCC1=CN1C.
What is the InChIKey of 1-methyl-2-propylazirine?
The InChIKey is JXRLSNVCELXOTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N/c1-3-4-6-5-7(6)2/h5H,3-4H2,1-2H3.
What are the key properties of 1-methyl-2-propylazirine?
1-methyl-2-propylazirine has a molecular weight of 97.16 g/mol, XLogP of 1.57, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-propylazirine is sourced from PubChem (CID 154550384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).