About 2-(4-methyl-1,2,4-triazol-3-yl)pyrazine
2-(4-methyl-1,2,4-triazol-3-yl)pyrazine (PubChem CID 15455218) has the molecular formula C7H7N5
and a molecular weight of 161.17 g/mol. Its IUPAC name is 2-(4-methyl-1,2,4-triazol-3-yl)pyrazine.
Molecular Properties
| Compound Name | 2-(4-methyl-1,2,4-triazol-3-yl)pyrazine |
| PubChem CID | 15455218 |
| Molecular Formula | C7H7N5 |
| Molecular Weight | 161.17 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | 2-(4-methyl-1,2,4-triazol-3-yl)pyrazine |
| SMILES | Cn1cnnc1-c1cnccn1 |
| InChI | InChI=1S/C7H7N5/c1-12-5-10-11-7(12)6-4-8-2-3-9-6/h2-5H,1H3 |
| InChIKey | FWXGCZIPPDQMGI-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.17 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-methyl-1,2,4-triazol-3-yl)pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methyl-1,2,4-triazol-3-yl)pyrazine?
The IUPAC name of 2-(4-methyl-1,2,4-triazol-3-yl)pyrazine (CID 15455218) is 2-(4-methyl-1,2,4-triazol-3-yl)pyrazine.
What is the SMILES notation for 2-(4-methyl-1,2,4-triazol-3-yl)pyrazine?
The canonical SMILES for 2-(4-methyl-1,2,4-triazol-3-yl)pyrazine is Cn1cnnc1-c1cnccn1.
What is the InChIKey of 2-(4-methyl-1,2,4-triazol-3-yl)pyrazine?
The InChIKey is FWXGCZIPPDQMGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N5/c1-12-5-10-11-7(12)6-4-8-2-3-9-6/h2-5H,1H3.
What are the key properties of 2-(4-methyl-1,2,4-triazol-3-yl)pyrazine?
2-(4-methyl-1,2,4-triazol-3-yl)pyrazine has a molecular weight of 161.17 g/mol, XLogP of 0.27, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-1,2,4-triazol-3-yl)pyrazine is sourced from PubChem (CID 15455218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).