C29H43N7O — CID 154553888
2-[[4-[8-(cyclohexylmethyl)-2,8-diazaspiro[4.5]decane-2-carbonyl]phenyl]methyl-(1H-imidazol-2-ylmethyl)amino]ethanimidamide (PubChem CID 154553888) has the molecular formula C29H43N7O and a molecular weight of 505.71 g/mol. Its IUPAC name is 2-[[4-[8-(cyclohexylmethyl)-2,8-diazaspiro[4.5]decane-2-carbonyl]phenyl]methyl-(1H-imidazol-2-ylmethyl)amino]ethanimidamide.
| Compound Name | 2-[[4-[8-(cyclohexylmethyl)-2,8-diazaspiro[4.5]decane-2-carbonyl]phenyl]methyl-(1H-imidazol-2-ylmethyl)amino]ethanimidamide |
|---|---|
| PubChem CID | 154553888 |
| Molecular Formula | C29H43N7O |
| Molecular Weight | 505.71 g/mol |
| Exact Mass | 505.35 |
| IUPAC Name | 2-[[4-[8-(cyclohexylmethyl)-2,8-diazaspiro[4.5]decane-2-carbonyl]phenyl]methyl-(1H-imidazol-2-ylmethyl)amino]ethanimidamide |
| SMILES | [H]/N=C(\N)CN(Cc1ccc(C(=O)N2CCC3(CCN(CC4CCCCC4)CC3)C2)cc1)Cc1ncc[nH]1 |
| InChI | InChI=1S/C29H43N7O/c30-26(31)20-35(21-27-32-13-14-33-27)19-24-6-8-25(9-7-24)28(37)36-17-12-29(22-36)10-15-34(16-11-29)18-23-4-2-1-3-5-23/h6-9,13-14,23H,1-5,10-12,15-22H2,(H3,30,31)(H,32,33) |
| InChIKey | BPFLLZJXOWQWQB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 105.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.71 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|