C20H25N3O3 — CID 154554074
(2Z,5E)-5-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethylidene)-2-ethoxyimino-3-ethyl-1,3-oxazolidin-4-one (PubChem CID 154554074) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is (2Z,5E)-5-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethylidene)-2-ethoxyimino-3-ethyl-1,3-oxazolidin-4-one.
| Compound Name | (2Z,5E)-5-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethylidene)-2-ethoxyimino-3-ethyl-1,3-oxazolidin-4-one |
|---|---|
| PubChem CID | 154554074 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | (2Z,5E)-5-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethylidene)-2-ethoxyimino-3-ethyl-1,3-oxazolidin-4-one |
| SMILES | CCO/N=C1\O/C(=C/c2cc3c4c(c2)CCCN4CCC3)C(=O)N1CC |
| InChI | InChI=1S/C20H25N3O3/c1-3-23-19(24)17(26-20(23)21-25-4-2)13-14-11-15-7-5-9-22-10-6-8-16(12-14)18(15)22/h11-13H,3-10H2,1-2H3/b17-13+,21-20- |
| InChIKey | ZMEPRDSDVRWJHM-NBEBQTRCSA-N |
| XLogP | 2.91 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|